3,5-dimethyl-2,6-diphenyl-oxan-4-one structure
|
Common Name | 3,5-dimethyl-2,6-diphenyl-oxan-4-one | ||
|---|---|---|---|---|
| CAS Number | 52186-16-0 | Molecular Weight | 280.36100 | |
| Density | 1.068g/cm3 | Boiling Point | 424.6ºC at 760 mmHg | |
| Molecular Formula | C19H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 3,5-dimethyl-2,6-diphenyloxan-4-one |
|---|
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 424.6ºC at 760 mmHg |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.36100 |
| Flash Point | 182.7ºC |
| Exact Mass | 280.14600 |
| PSA | 26.30000 |
| LogP | 4.34050 |
| Index of Refraction | 1.546 |
| InChIKey | RNIDGKHRURDCDH-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C(C)C(c2ccccc2)OC1c1ccccc1 |
|
~%
3,5-dimethyl-2,... CAS#:52186-16-0 |
| Literature: Mangalam; Gurumurthy; Arul; Karthikeyan Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1996 , vol. 35, # 5 p. 413 - 417 |
|
~%
3,5-dimethyl-2,... CAS#:52186-16-0 |
| Literature: Vorlaender; Hobohm Chemische Berichte, 1896 , vol. 29, p. 1840 |
|
~%
3,5-dimethyl-2,... CAS#:52186-16-0 |
| Literature: Vorlaender; Hobohm Chemische Berichte, 1896 , vol. 29, p. 1352 |