2-Carbethoxy-2-(beta-phenylethyl)cyclooctanone
Modify Date: 2025-08-28 13:16:27
2-Carbethoxy-2-(beta-phenylethyl)cyclooctanone structure
|
Common Name | 2-Carbethoxy-2-(beta-phenylethyl)cyclooctanone | ||
|---|---|---|---|---|
| CAS Number | 52186-03-5 | Molecular Weight | 302.40800 | |
| Density | 1.045g/cm3 | Boiling Point | 417.4ºC at 760mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181ºC | |
| Name | ethyl 2-oxo-1-(2-phenylethyl)cyclooctane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 417.4ºC at 760mmHg |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 181ºC |
| Exact Mass | 302.18800 |
| PSA | 43.37000 |
| LogP | 4.09200 |
| Index of Refraction | 1.508 |
| InChIKey | LFHWQJCOAQWRSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCc2ccccc2)CCCCCCC1=O |
| HS Code | 2918300090 |
|---|
|
~%
2-Carbethoxy-2-... CAS#:52186-03-5 |
| Literature: Carlson,G.L. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 154 - 157 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-oxo-1-phenethylcyclooctane-1-carboxylate |
| Cyclooctanecarboxylic acid,2-oxo-1-(2-phenylethyl)-,ethyl ester |
| Ethyl 2-oxo-1-(2-phenylethyl)cyclooctanecarboxylate |