2-Propen-1-one,3-(3-chlorophenyl)-1-(4-chlorophenyl)-
Modify Date: 2025-08-21 18:26:35
2-Propen-1-one,3-(3-chlorophenyl)-1-(4-chlorophenyl)- structure
|
Common Name | 2-Propen-1-one,3-(3-chlorophenyl)-1-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 52182-41-9 | Molecular Weight | 277.14500 | |
| Density | 1.296g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | 3-(3-chlorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2O |
| Molecular Weight | 277.14500 |
| Flash Point | 177.7ºC |
| Exact Mass | 276.01100 |
| PSA | 17.07000 |
| LogP | 4.88950 |
| Index of Refraction | 1.638 |
| InChIKey | ZUFZZJRGYBWUDG-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1cccc(Cl)c1)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:1878-65-5
CAS#:74-11-3
CAS#:649739-67-3| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Propen-1-one,3-(3-chlorophenyl)-1-(4-chlorophenyl) |
| 3,4'-Dichlorochalcone |
| Chalcone,3,4'-dichloro-(7CI) |