ethyl 2-(4-ethenylphenoxy)-2-methylpropanoate
Modify Date: 2024-02-05 00:25:33
ethyl 2-(4-ethenylphenoxy)-2-methylpropanoate structure
|
Common Name | ethyl 2-(4-ethenylphenoxy)-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 52179-09-6 | Molecular Weight | 234.29100 | |
| Density | 1.039g/cm3 | Boiling Point | 327.3ºC at 760mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.8ºC | |
| Name | ethyl 2-(4-ethenylphenoxy)-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 327.3ºC at 760mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 134.8ºC |
| Exact Mass | 234.12600 |
| PSA | 35.53000 |
| LogP | 3.05010 |
| Index of Refraction | 1.522 |
| InChIKey | BYZWKIOOOBNGRO-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(OC(C)(C)C(=O)OCC)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 2-(4-vinylphenoxy)isobutyrate |
| EINECS 257-707-4 |
| ethyl 2-methyl-2-(4-vinylphenoxy)propanoate |