2-AMINO-6-METHOXYQUINOLIN-4-OL structure
|
Common Name | 2-AMINO-6-METHOXYQUINOLIN-4-OL | ||
|---|---|---|---|---|
| CAS Number | 52176-55-3 | Molecular Weight | 190.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-6-methoxy-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O2 |
|---|---|
| Molecular Weight | 190.19900 |
| Exact Mass | 190.07400 |
| PSA | 68.37000 |
| LogP | 2.11240 |
| InChIKey | BIILCANEHQNHMY-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(N)cc(=O)c2c1 |
| HS Code | 2933499090 |
|---|
|
~%
2-AMINO-6-METHO... CAS#:52176-55-3 |
| Literature: Pfizer Inc. Patent: US4247699 A1, 1981 ; |
|
~%
2-AMINO-6-METHO... CAS#:52176-55-3 |
| Literature: Hardman; Partridge Journal of the Chemical Society, 1954 , p. 3878,3881 |
|
~%
2-AMINO-6-METHO... CAS#:52176-55-3 |
| Literature: Hardman; Partridge Journal of the Chemical Society, 1955 , p. 510,513 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-AMINO-6-METHOXYQUINOLIN-4-OL |
| 2-Amino-4-hydroxy-6-methoxyquinoline |