[[C-(3-acetylphenoxy)-N-methylcarbonimidoyl]amino] N-methylcarbamate structure
|
Common Name | [[C-(3-acetylphenoxy)-N-methylcarbonimidoyl]amino] N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 52174-15-9 | Molecular Weight | 265.26500 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[C-(3-acetylphenoxy)-N-methylcarbonimidoyl]amino] N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.26500 |
| Exact Mass | 265.10600 |
| PSA | 92.51000 |
| LogP | 1.70970 |
| Index of Refraction | 1.544 |
| InChIKey | IZZSIUZPUHEWHK-UHFFFAOYSA-N |
| SMILES | CN=C(NOC(=O)NC)Oc1cccc(C(C)=O)c1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(3-(((Methylamino)carbonyl)oxy)phenyl)ethanone O-((methylamino)carbonyl)oxime |
| Ethanone,1-(3-(((methylamino)carbonyl)oxy)phenyl)-,O-((methylamino)carbonyl)oxime |