N-[(2,2-dimethylcyclohexylidene)amino]-2,4-dinitro-aniline structure
|
Common Name | N-[(2,2-dimethylcyclohexylidene)amino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 5212-74-8 | Molecular Weight | 306.31700 | |
| Density | 1.36g/cm3 | Boiling Point | 435.3ºC at 760 mmHg | |
| Molecular Formula | C14H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | N-[(2,2-dimethylcyclohexylidene)amino]-2,4-dinitroaniline |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 435.3ºC at 760 mmHg |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.31700 |
| Flash Point | 217.1ºC |
| Exact Mass | 306.13300 |
| PSA | 116.03000 |
| LogP | 4.99050 |
| Index of Refraction | 1.625 |
| InChIKey | QNGFTWVAGYFSOW-DTQAZKPQSA-N |
| SMILES | CC1(C)CCCCC1=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
N-[(2,2-dimethy... CAS#:5212-74-8 |
| Literature: Adamson; Marlow; Simonsen Journal of the Chemical Society, 1938 , p. 774 |
|
~%
N-[(2,2-dimethy... CAS#:5212-74-8 |
| Literature: Adamson; Marlow; Simonsen Journal of the Chemical Society, 1938 , p. 774 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |