3-[3-(Dimethylamino)propoxy]-p-cymene-2-carboxylic acid methyl ester structure
|
Common Name | 3-[3-(Dimethylamino)propoxy]-p-cymene-2-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 52073-31-1 | Molecular Weight | 293.40100 | |
| Density | 1.008g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C17H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | methyl 2-[3-(dimethylamino)propoxy]-6-methyl-3-propan-2-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.40100 |
| Flash Point | 189.7ºC |
| Exact Mass | 293.19900 |
| PSA | 38.77000 |
| LogP | 3.23550 |
| Index of Refraction | 1.502 |
| InChIKey | FGVITAFIUFLYQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)ccc(C(C)C)c1OCCCN(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 3-(3-(dimethylamino)propoxy)-p-cymene-2-carboxylate |
| p-CYMENE-2-CARBOXYLIC ACID,3-(3-(DIMETHYLAMINO)PROPOXY)-,METHYL ESTER |