2H-1,4-Oxazine-6-carboxylicacid, 5-(5-chloro-2-hydroxyphenyl)-3,4-dihydro-2-phenyl-, d-lactone (7CI,8CI) structure
|
Common Name | 2H-1,4-Oxazine-6-carboxylicacid, 5-(5-chloro-2-hydroxyphenyl)-3,4-dihydro-2-phenyl-, d-lactone (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 5207-29-4 | Molecular Weight | 313.73500 | |
| Density | 1.45g/cm3 | Boiling Point | 521.9ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | 9-chloro-3-phenyl-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 521.9ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.73500 |
| Flash Point | 269.4ºC |
| Exact Mass | 313.05100 |
| PSA | 51.47000 |
| LogP | 4.13000 |
| Index of Refraction | 1.685 |
| InChIKey | GVJLHYLHJNSGCD-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc(Cl)cc2c2c1OC(c1ccccc1)CN2 |
|
~%
2H-1,4-Oxazine-... CAS#:5207-29-4 |
| Literature: Newman,M.S.; Dalton,C.K. Journal of Organic Chemistry, 1965 , vol. 30, p. 4126 - 4131 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [1]Benzopyrano[3,4]oxazin-5(1H)-one,9-chloro-2,3-dihydro-3-phenyl |
| 9-chloro-3-phenyl-2,3-dihydrochromeno[3,4-b][1,4]oxazin-5(1H)-one |