3-[(triphenyl-λ5-phosphanylidene)amino]cyclohex-2-en-1-one structure
|
Common Name | 3-[(triphenyl-λ5-phosphanylidene)amino]cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 52035-11-7 | Molecular Weight | 371.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22NOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(triphenyl-λ5-phosphanylidene)amino]cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H22NOP |
|---|---|
| Molecular Weight | 371.41100 |
| Exact Mass | 371.14400 |
| PSA | 39.24000 |
| LogP | 4.80100 |
| InChIKey | VHWAJFNCRKJIRD-UHFFFAOYSA-N |
| SMILES | O=C1C=C(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1 |
|
~96%
3-[(triphenyl-λ... CAS#:52035-11-7 |
| Literature: Nitta; Soeda; Iino Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 3 p. 932 - 934 |
|
~%
3-[(triphenyl-λ... CAS#:52035-11-7 |
| Literature: Molina; Molina, Pedro; Pastor; Pastor, Aurelia; Vilaplana; Vilaplana, Maria Jesus; Foces-Foces; Foces-Foces, Concepcion Tetrahedron, 1995 , vol. 51, # 4 p. 1265 - 1276 |
| 2-Cyclohexen-1-one,3-[(triphenylphosphoranylidene)amino] |