Anthallan
Modify Date: 2025-08-25 22:24:22
Anthallan structure
|
Common Name | Anthallan | ||
|---|---|---|---|---|
| CAS Number | 520-47-8 | Molecular Weight | 323.38400 | |
| Density | 1.235g/cm3 | Boiling Point | 498.4ºC at 760mmHg | |
| Molecular Formula | C17H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.2ºC | |
| Name | 3-[(dibutylamino)methyl]-4,5,6-trihydroxy-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 498.4ºC at 760mmHg |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.38400 |
| Flash Point | 255.2ºC |
| Exact Mass | 323.17300 |
| PSA | 90.23000 |
| LogP | 2.91710 |
| Index of Refraction | 1.576 |
| InChIKey | UHXNHWOEFZXDCC-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CC1OC(=O)c2cc(O)c(O)c(O)c21 |
| HS Code | 2932209090 |
|---|
|
~%
Anthallan CAS#:520-47-8 |
| Literature: Hazleton Journal of the American Pharmaceutical Association (1912-1977), 1949 , vol. 38, p. 433 Full Text Show Details Loewe Patent: US2268990 , 1939 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-70K7ST68DA |
| 3-((Dibutylamino)methyl)-4,5,6-trihydroxyphthalide |
| Anthallan free base |
| Phthalide,3-((dibutylamino)methyl)-4,5,6-trihydroxy |
| Anthallan |