Cyclopentanecarboxylicacid, 1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)- structure
|
Common Name | Cyclopentanecarboxylicacid, 1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 51971-46-1 | Molecular Weight | 259.25700 | |
| Density | 1.476g/cm3 | Boiling Point | 448.8ºC at 760mmHg | |
| Molecular Formula | C14H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 1-(1,3-dioxoisoindol-2-yl)cyclopentane-1-carboxylic acid |
|---|
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760mmHg |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.25700 |
| Flash Point | 225.2ºC |
| Exact Mass | 259.08400 |
| PSA | 74.68000 |
| LogP | 1.61790 |
| Index of Refraction | 1.658 |
| InChIKey | FGGDAJNZNPBPGM-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1C1(C(=O)O)CCCC1 |
| HS Code | 2925190090 |
|---|
|
~%
Cyclopentanecar... CAS#:51971-46-1 |
| Literature: Mohar, Barbara; Sterk, Damjan; Ferron, Laurent; Cahard, Dominique Tetrahedron Letters, 2005 , vol. 46, # 30 p. 5029 - 5031 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |