N-(2-bromo-2,2-dichloro-1-hydroxyethyl)benzamide
Modify Date: 2025-09-27 09:52:49
N-(2-bromo-2,2-dichloro-1-hydroxyethyl)benzamide structure
|
Common Name | N-(2-bromo-2,2-dichloro-1-hydroxyethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 51945-75-6 | Molecular Weight | 312.97500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrCl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-bromo-2,2-dichloro-1-hydroxyethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8BrCl2NO2 |
|---|---|
| Molecular Weight | 312.97500 |
| Exact Mass | 310.91200 |
| PSA | 52.82000 |
| LogP | 2.83590 |
| InChIKey | ZYDBNMIPMJSGOI-UHFFFAOYSA-N |
| SMILES | O=C(NC(O)C(Cl)(Cl)Br)c1ccccc1 |
|
~%
N-(2-bromo-2,2-... CAS#:51945-75-6 |
| Literature: Yelburgi; Wheeler Journal of the Indian Chemical Society, 1934 , vol. 11, p. 217,219, 221 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-(2-bromo-2,2-dichloro-1-hydroxyethyl) |