4-hexylundecane-2,5-dione structure
|
Common Name | 4-hexylundecane-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 51916-50-8 | Molecular Weight | 268.43500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hexylundecane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H32O2 |
|---|---|
| Molecular Weight | 268.43500 |
| Exact Mass | 268.24000 |
| PSA | 34.14000 |
| LogP | 5.09160 |
| InChIKey | ZDPOLEWKVBWIJP-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)C(CCCCCC)CC(C)=O |
|
~%
4-hexylundecane... CAS#:51916-50-8 |
| Literature: Pelter,A. et al. Tetrahedron Letters, 1973 , # 45 p. 4491 - 4494 |
|
~%
4-hexylundecane... CAS#:51916-50-8 |
| Literature: Pelter,A. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2428 - 2434 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2,5-Undecanedione,4-hexyl |
| 4-hexyl-undecane-2,5-dione |
| 4-hexyl-2,5-undecanedione |