2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone structure
|
Common Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone | ||
|---|---|---|---|---|
| CAS Number | 519-96-0 | Molecular Weight | 332.26200 | |
| Density | 1.73g/cm3 | Boiling Point | 684.1ºC at 760mmHg | |
| Molecular Formula | C16H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.8ºC | |
| Name | patuletin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 684.1ºC at 760mmHg |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26200 |
| Flash Point | 258.8ºC |
| Exact Mass | 332.05300 |
| PSA | 140.59000 |
| LogP | 1.99660 |
| Index of Refraction | 1.772 |
| InChIKey | JMIFIYIEXODVTO-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-O-Methylquercetagetin |
| 6-Methoxyquercetin |
| 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxychromen-4-one |
| 3,5,7,3',4'-Pentahydroxy-6-methoxyflavone |
| Quercetagetin 6-methyl ether |
| 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone |
| Patuletin |