Axillarin
Modify Date: 2025-08-23 08:16:44
Axillarin structure
|
Common Name | Axillarin | ||
|---|---|---|---|---|
| CAS Number | 5188-73-8 | Molecular Weight | 346.29 | |
| Density | 1.65g/cm3 | Boiling Point | 684.7ºC at 760mmHg | |
| Molecular Formula | C17H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
Use of AxillarinAxillarin is a natural flavonoid with anti-glycating and anti-oxidant effects[1]. |
| Name | axillarin |
|---|---|
| Synonym | More Synonyms |
| Description | Axillarin is a natural flavonoid with anti-glycating and anti-oxidant effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 684.7ºC at 760mmHg |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 |
| Flash Point | 255.6ºC |
| Exact Mass | 346.06900 |
| PSA | 129.59000 |
| LogP | 2.29960 |
| Index of Refraction | 1.731 |
| InChIKey | KIGVXRGRNLQNNI-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Quercetagetin 3,6-dimethyl ether |
| 3',4',5,7-Tetrahydroxy-3,6-dimethoxyflavone |
| 3,6-Dimethoxyquercetagetin |
| Axillarin |
| DMQT |
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxychromen-4-one |