5-Bromo-2-chloro-1,3-dinitrobenzene structure
|
Common Name | 5-Bromo-2-chloro-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 51796-82-8 | Molecular Weight | 281.44800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2BrClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Bromo-2-chloro-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H2BrClN2O4 |
|---|---|
| Molecular Weight | 281.44800 |
| Exact Mass | 279.88900 |
| PSA | 91.64000 |
| LogP | 3.96530 |
| InChIKey | GWQNTICVTKSXRW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)cc([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
|
~%
5-Bromo-2-chlor... CAS#:51796-82-8 |
| Literature: Sane; Joshi Journal of the Indian Chemical Society, 1932 , vol. 9, p. 59,63 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-bromanyl-2-chloranyl-1,3-dinitro-benzene |