Benzoicacid, 4-chloro-, 2-[(4-methoxyphenyl)methylene]hydrazide
Modify Date: 2025-09-20 18:47:06
![Benzoicacid, 4-chloro-, 2-[(4-methoxyphenyl)methylene]hydrazide Structure](https://image.chemsrc.com/caspic/334/51771-28-9.png)
Benzoicacid, 4-chloro-, 2-[(4-methoxyphenyl)methylene]hydrazide structure
|
Common Name | Benzoicacid, 4-chloro-, 2-[(4-methoxyphenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 51771-28-9 | Molecular Weight | 288.72900 | |
| Density | 1.2g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.72900 |
| Exact Mass | 288.06700 |
| PSA | 50.69000 |
| LogP | 3.50340 |
| Index of Refraction | 1.579 |
| InChIKey | LKVQAJOKAKNCOO-LICLKQGHSA-N |
| SMILES | COc1ccc(C=NNC(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
Benzoicacid, 4-... CAS#:51771-28-9 |
| Literature: Dave; Patel; Langalia; Thaker Journal of the Indian Chemical Society, 1984 , vol. 61, # 10 p. 891 - 892 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| t4302 |