ethyl 2-acetylundecanoate
Modify Date: 2025-08-27 19:58:00
ethyl 2-acetylundecanoate structure
|
Common Name | ethyl 2-acetylundecanoate | ||
|---|---|---|---|---|
| CAS Number | 51688-56-3 | Molecular Weight | 256.38100 | |
| Density | 0.925 | Boiling Point | 292ºC | |
| Molecular Formula | C15H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119ºC | |
| Name | ethyl 2-acetylundecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.925 |
|---|---|
| Boiling Point | 292ºC |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.38100 |
| Flash Point | 119ºC |
| Exact Mass | 256.20400 |
| PSA | 43.37000 |
| LogP | 3.89540 |
| Index of Refraction | 1.442 |
| InChIKey | PSZKHWIWRLMMKZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(C(C)=O)C(=O)OCC |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Nonyl-acetessigsaeure-aethylester |
| Undecanoic acid,2-acetyl-,ethyl ester |
| 2-nonyl-acetoacetic acid ethyl ester |
| ethyl 2-nonylacetoacetate |
| 2-acetyl-undecanoic acid ethyl ester |
| Ethyl a-nonylacetoacetate |