n-(p-(difluoromethoxy)phenyl)-anthranilicaci
Modify Date: 2025-10-07 08:56:46
n-(p-(difluoromethoxy)phenyl)-anthranilicaci structure
|
Common Name | n-(p-(difluoromethoxy)phenyl)-anthranilicaci | ||
|---|---|---|---|---|
| CAS Number | 51679-46-0 | Molecular Weight | 279.23900 | |
| Density | N/A | Boiling Point | 412.6ºC at 760mmHg | |
| Molecular Formula | C14H11F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 2-[4-(difluoromethoxy)anilino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 412.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H11F2NO3 |
| Molecular Weight | 279.23900 |
| Flash Point | 203.3ºC |
| Exact Mass | 279.07100 |
| PSA | 58.56000 |
| LogP | 3.80280 |
| Index of Refraction | 1.599 |
| InChIKey | VATLFRMTHALRQT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccc(OC(F)F)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
n-(p-(difluorom... CAS#:51679-46-0 |
| Literature: Endel'man,E.S. et al. Pharmaceutical Chemistry Journal, 1973 , vol. 7, # 12 p. 755 - 759 Khimiko-Farmatsevticheskii Zhurnal, 1973 , vol. 7, # 12 p. 15 - 19 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-((4-(difluoromethoxy)phenyl)amino) |
| N-(p-(Difluoromethoxy)phenyl)anthranilic acid |
| Anthranilic acid,N-(p-(difluoromethoxy)phenyl) |
| 2-{[4-(difluoromethoxy)phenyl]amino}benzoic acid |