(2,4-dinitrophenyl)sulfanyl-ethoxy-methanethione structure
|
Common Name | (2,4-dinitrophenyl)sulfanyl-ethoxy-methanethione | ||
|---|---|---|---|---|
| CAS Number | 51676-65-4 | Molecular Weight | 288.30000 | |
| Density | 1.52g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | O-ethyl (2,4-dinitrophenyl)sulfanylmethanethioate |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Molecular Formula | C9H8N2O5S2 |
| Molecular Weight | 288.30000 |
| Flash Point | 210.8ºC |
| Exact Mass | 287.98700 |
| PSA | 158.26000 |
| LogP | 3.96290 |
| Index of Refraction | 1.66 |
| InChIKey | FMFAWKHZVNLCBI-UHFFFAOYSA-N |
| SMILES | CCOC(=S)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
(2,4-dinitrophe... CAS#:51676-65-4 |
| Literature: Gupta,S.P.; Dureja,P. Journal of the Indian Chemical Society, 1973 , vol. 50, p. 546 - 548 |
|
~%
(2,4-dinitrophe... CAS#:51676-65-4 |
| Literature: Humeres, Eduardo; Soldi, Valdir; Klug, Marilene; Nunes, Mauricea; Oliveira, Celia M.S.; Barrie, Patrick J. Canadian Journal of Chemistry, 1999 , vol. 77, # 5-6 p. 1050 - 1056 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |