1-(2,4-Dichlorobenzyl)piperazine structure
|
Common Name | 1-(2,4-Dichlorobenzyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 51619-56-8 | Molecular Weight | 245.148 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 332.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H14Cl2N2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 154.8±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[(2,4-dichlorophenyl)methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.4±37.0 °C at 760 mmHg |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.148 |
| Flash Point | 154.8±26.5 °C |
| Exact Mass | 244.053406 |
| PSA | 15.27000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | VYKXBWXIOSLDQR-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CN2CCNCC2)c(Cl)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~98%
1-(2,4-Dichloro... CAS#:51619-56-8 |
| Literature: Zhang, Cunlong; Tan, Chunyan; Zu, Xuyu; Zhai, Xin; Liu, Feng; Chu, Bizhu; Ma, Xiaohua; Chen, Yuzong; Gong, Ping; Jiang, Yuyang European Journal of Medicinal Chemistry, 2011 , vol. 46, # 4 p. 1404 - 1414 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2,4-Dichlorobenzyl)piperazine |
| MFCD03407487 |
| Piperazine, 1-[(2,4-dichlorophenyl)methyl]- |