Propanedioic acid,2-(3-methylbutylidene)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(3-methylbutylidene)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 51615-30-6 | Molecular Weight | 228.28500 | |
| Density | 1.003g/cm3 | Boiling Point | 253.5ºC at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.2ºC | |
| Name | diethyl 2-(3-methylbutylidene)propanedioate |
|---|
| Density | 1.003g/cm3 |
|---|---|
| Boiling Point | 253.5ºC at 760 mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 111.2ºC |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.08510 |
| Index of Refraction | 1.449 |
| InChIKey | WSMCGEUISONHKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CCC(C)C)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |