naphthalene; 2,4,6-trinitrophenol
Modify Date: 2025-11-28 16:31:33
naphthalene; 2,4,6-trinitrophenol structure
|
Common Name | naphthalene; 2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 5160-53-2 | Molecular Weight | 357.27400 | |
| Density | N/A | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C16H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | naphthalene compound with picric acid (1:1) |
|---|
| Boiling Point | 303.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H11N3O7 |
| Molecular Weight | 357.27400 |
| Flash Point | 133.9ºC |
| Exact Mass | 357.06000 |
| PSA | 157.69000 |
| LogP | 5.52620 |
| InChIKey | ZYEFWJUGWXZMHM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc2ccccc2c1 |
|
~%
naphthalene; 2,... CAS#:5160-53-2 |
| Literature: Seal, B. K.; Mukherjee, A. K. Indian Journal of Chemistry, Section A: Inorganic, Physical, Theoretical & Analytical, 1986 , vol. 25, # 5 p. 413 - 415 |
CAS#:1152-90-5