dimethyl (1,1,1-trichloro-2-methyl-3-oxobutan-2-yl) phosphate
Modify Date: 2025-10-26 12:13:43
dimethyl (1,1,1-trichloro-2-methyl-3-oxobutan-2-yl) phosphate structure
|
Common Name | dimethyl (1,1,1-trichloro-2-methyl-3-oxobutan-2-yl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 5155-86-2 | Molecular Weight | 313.50000 | |
| Density | 1.433g/cm3 | Boiling Point | 297.6ºC at 760mmHg | |
| Molecular Formula | C7H12Cl3O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | dimethyl (1,1,1-trichloro-2-methyl-3-oxobutan-2-yl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 297.6ºC at 760mmHg |
| Molecular Formula | C7H12Cl3O5P |
| Molecular Weight | 313.50000 |
| Flash Point | 171ºC |
| Exact Mass | 311.94900 |
| PSA | 71.64000 |
| LogP | 3.12180 |
| Index of Refraction | 1.47 |
| InChIKey | SNFGQLSLQMSTFC-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)OC(C)(C(C)=O)C(Cl)(Cl)Cl |
|
~%
dimethyl (1,1,1... CAS#:5155-86-2 |
| Literature: Bentrude,W.G. Journal of the American Chemical Society, 1965 , vol. 87, # 17 p. 4026 - 4027 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dimethyl 1,1,1-trichloro-2-methyl-3-oxobutan-2-yl phosphate |