chloro-[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilane
Modify Date: 2025-09-02 17:39:39
![chloro-[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilane Structure](https://image.chemsrc.com/caspic/195/51531-19-2.png)
chloro-[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilane structure
|
Common Name | chloro-[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 51531-19-2 | Molecular Weight | 283.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H27ClSi4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H27ClSi4 |
|---|---|
| Molecular Weight | 283.10600 |
| Exact Mass | 282.08800 |
| LogP | 4.42050 |
| InChIKey | YBTSNEYHVYJGCP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)Cl |
|
~52%
chloro-[[dimeth... CAS#:51531-19-2 |
| Literature: Ishikawa, Mitsuo; Iyoda, Jun; Ikeda, Haruhiko; Kotake, Kazunori; Hashimoto, Toshio; Kumada, Makoto Journal of the American Chemical Society, 1981 , vol. 103, # 16 p. 4845 - 4850 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![[dimethyl(trimethylsilyl)silyl]-[[[[dimethyl(trimethylsilyl)silyl]-dimethylsilyl]-dimethylsilyl]-dimethylsilyl]-dimethylsilane structure](https://image.chemsrc.com/caspic/433/3704-48-1.png)
CAS#:3704-48-1| Tetrasilane,1-chloro-1,1,2,2,3,3,4,4,4-nonamethyl |