2-Butene-1,4-diaminium,N1,N1,N1,N4,N4,N4-hexa-2-propen-1-yl-, bromide (1:2) structure
|
Common Name | 2-Butene-1,4-diaminium,N1,N1,N1,N4,N4,N4-hexa-2-propen-1-yl-, bromide (1:2) | ||
|---|---|---|---|---|
| CAS Number | 51523-45-6 | Molecular Weight | 328.53500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H36N2++ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(prop-2-enyl)-[4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]azanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H36N2++ |
|---|---|
| Molecular Weight | 328.53500 |
| Exact Mass | 328.28800 |
| LogP | 4.29220 |
| InChIKey | LPQWSHZCDQSVEG-BUHFOSPRSA-N |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=CC[N+](CC=C)(CC=C)CC=C |
|
~%
2-Butene-1,4-di... CAS#:51523-45-6 |
| Literature: Butler; Goette Journal of the American Chemical Society, 1954 , vol. 76, p. 2418,2419 |
|
~%
2-Butene-1,4-di... CAS#:51523-45-6 |
| Literature: Butler; Goette Journal of the American Chemical Society, 1954 , vol. 76, p. 2418,2419 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| triprop-2-enyl-[(E)-4-triprop-2-enylammoniobut-2-enyl]azanium |