2-(1,3-benzodioxol-5-yl)-5,7-dihydroxy-3-methoxychromen-4-one
Modify Date: 2024-04-04 23:18:49
2-(1,3-benzodioxol-5-yl)-5,7-dihydroxy-3-methoxychromen-4-one structure
|
Common Name | 2-(1,3-benzodioxol-5-yl)-5,7-dihydroxy-3-methoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 5150-31-2 | Molecular Weight | 328.27300 | |
| Density | 1.62g/cm3 | Boiling Point | 583ºC at 760 mmHg | |
| Molecular Formula | C17H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5ºC | |
| Name | 2-(1,3-benzodioxol-5-yl)-5,7-dihydroxy-3-methoxychromen-4-one |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 583ºC at 760 mmHg |
| Molecular Formula | C17H12O7 |
| Molecular Weight | 328.27300 |
| Flash Point | 220.5ºC |
| Exact Mass | 328.05800 |
| PSA | 98.36000 |
| LogP | 2.60850 |
| Index of Refraction | 1.724 |
| InChIKey | BWGOSISPGLXOML-UHFFFAOYSA-N |
| SMILES | COc1c(-c2ccc3c(c2)OCO3)oc2cc(O)cc(O)c2c1=O |
| HS Code | 2932999099 |
|---|
|
~%
2-(1,3-benzodio... CAS#:5150-31-2 |
| Literature: Briggs; Locker Journal of the Chemical Society, 1949 , p. 2162 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:93655-95-9| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |