Bucainide
Modify Date: 2025-08-25 10:39:32
Bucainide structure
|
Common Name | Bucainide | ||
|---|---|---|---|---|
| CAS Number | 51481-62-0 | Molecular Weight | 329.52300 | |
| Density | 0.97g/cm3 | Boiling Point | 431.9ºC at 760 mmHg | |
| Molecular Formula | C21H35N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215ºC | |
| Name | 1-(4-hexylpiperazin-1-yl)-N-(2-methylpropyl)-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760 mmHg |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.52300 |
| Flash Point | 215ºC |
| Exact Mass | 329.28300 |
| PSA | 18.84000 |
| LogP | 4.16290 |
| Index of Refraction | 1.532 |
| InChIKey | WRNQYBXJRPAGNS-UHFFFAOYSA-N |
| SMILES | CCCCCCN1CCN(C(=NCC(C)C)c2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bucainidum [INN-Latin] |
| UNII-F0D4M5RASG |
| Bucainide |
| Bucainida |
| Bucainida [INN-Spanish] |
| Bucainide [INN] |
| 1-Hexyl-4-(N-isobutylbenzimidoyl)piperazin |
| Bucainidum |