5-Pentyl-1,3-diphenylbarbituric acid
Modify Date: 2024-02-01 17:56:53
5-Pentyl-1,3-diphenylbarbituric acid structure
|
Common Name | 5-Pentyl-1,3-diphenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 5148-23-2 | Molecular Weight | 350.41100 | |
| Density | 1.193g/cm3 | Boiling Point | 473.4ºC at 760 mmHg | |
| Molecular Formula | C21H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 5-pentyl-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 473.4ºC at 760 mmHg |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.41100 |
| Flash Point | 195.2ºC |
| Exact Mass | 350.16300 |
| PSA | 57.69000 |
| LogP | 4.51290 |
| Index of Refraction | 1.582 |
| InChIKey | JWQYKFIJMDTUFX-UHFFFAOYSA-N |
| SMILES | CCCCCC1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Barbituric acid,1,3-diphenyl-5-pentyl |
| 5-Pentyl-1,3-diphenylbarbituric acid |
| 1,3-Diphenyl-5-pentyl-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 1,3-Diphenyl-5-pentylbarbituric acid |