Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio]- structure
|
Common Name | Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio]- | ||
|---|---|---|---|---|
| CAS Number | 51431-75-5 | Molecular Weight | 296.35100 | |
| Density | 1.21g/cm3 | Boiling Point | 326ºC at 760 mmHg | |
| Molecular Formula | C16H15F3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760 mmHg |
| Molecular Formula | C16H15F3S |
| Molecular Weight | 296.35100 |
| Flash Point | 151ºC |
| Exact Mass | 296.08500 |
| PSA | 25.30000 |
| LogP | 5.78180 |
| Index of Refraction | 1.555 |
| InChIKey | LSSRWXVDMDSZTH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Sc2ccc(C(F)(F)F)cc2)c(C)c1 |
|
~%
Benzene,1,3,5-t... CAS#:51431-75-5 |
| Literature: Truce,W.E.; Guy,M.M. Journal of Organic Chemistry, 1961 , vol. 26, p. 4331 - 4336 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |