N-(4-cyclohexylphenyl)-N-hydroxyacetamide structure
|
Common Name | N-(4-cyclohexylphenyl)-N-hydroxyacetamide | ||
|---|---|---|---|---|
| CAS Number | 51410-58-3 | Molecular Weight | 233.30600 | |
| Density | 1.147g/cm3 | Boiling Point | 390.5ºC at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | N-(4-cyclohexylphenyl)-N-hydroxyacetamide |
|---|
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 390.5ºC at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 190ºC |
| Exact Mass | 233.14200 |
| PSA | 40.54000 |
| LogP | 3.47640 |
| Index of Refraction | 1.583 |
| InChIKey | QDZCAEYIGSMUGC-UHFFFAOYSA-N |
| SMILES | CC(=O)N(O)c1ccc(C2CCCCC2)cc1 |
|
~%
N-(4-cyclohexyl... CAS#:51410-58-3 |
| Literature: Mangold; Hanna Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 630 - 638 |
|
~%
N-(4-cyclohexyl... CAS#:51410-58-3 |
| Literature: Mangold; Hanna Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 630 - 638 |
|
~%
N-(4-cyclohexyl... CAS#:51410-58-3 |
| Literature: Mangold; Hanna Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 630 - 638 |