2-(4-methylphenyl)sulfonyl-1,1,2-triphenyl-ethanol
Modify Date: 2025-10-01 09:28:29
2-(4-methylphenyl)sulfonyl-1,1,2-triphenyl-ethanol structure
|
Common Name | 2-(4-methylphenyl)sulfonyl-1,1,2-triphenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 51384-41-9 | Molecular Weight | 428.54300 | |
| Density | 1.232g/cm3 | Boiling Point | 619.4ºC at 760 mmHg | |
| Molecular Formula | C27H24O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.4ºC | |
| Name | 2-(4-methylphenyl)sulfonyl-1,1,2-triphenylethanol |
|---|
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 619.4ºC at 760 mmHg |
| Molecular Formula | C27H24O3S |
| Molecular Weight | 428.54300 |
| Flash Point | 328.4ºC |
| Exact Mass | 428.14500 |
| PSA | 62.75000 |
| LogP | 6.52690 |
| Index of Refraction | 1.639 |
| InChIKey | GPZZPNBJJQLWBF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccccc2)C(O)(c2ccccc2)c2ccccc2)cc1 |
|
~%
2-(4-methylphen... CAS#:51384-41-9 |
| Literature: Kaiser,E.M. et al. Journal of Organometallic Chemistry, 1973 , vol. 59, p. 53 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |