2-(diethoxyphosphorylsulfanylmethyl)-6-methylpyridazin-3-one structure
|
Common Name | 2-(diethoxyphosphorylsulfanylmethyl)-6-methylpyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 51356-11-7 | Molecular Weight | 292.29200 | |
| Density | 1.32g/cm3 | Boiling Point | 379.1ºC at 760 mmHg | |
| Molecular Formula | C10H17N2O4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | 2-(diethoxyphosphorylsulfanylmethyl)-6-methylpyridazin-3-one |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 379.1ºC at 760 mmHg |
| Molecular Formula | C10H17N2O4PS |
| Molecular Weight | 292.29200 |
| Flash Point | 183ºC |
| Exact Mass | 292.06500 |
| PSA | 105.53000 |
| LogP | 2.42350 |
| Index of Refraction | 1.563 |
| InChIKey | DRYHEBJYIPWIDT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SCn1nc(C)ccc1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |