2-(diethoxyphosphinothioylsulfanylmethyl)-6-methylpyridazin-3-one structure
|
Common Name | 2-(diethoxyphosphinothioylsulfanylmethyl)-6-methylpyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 51356-09-3 | Molecular Weight | 308.35700 | |
| Density | 1.32g/cm3 | Boiling Point | 387.6ºC at 760 mmHg | |
| Molecular Formula | C10H17N2O3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | 2-(diethoxyphosphinothioylsulfanylmethyl)-6-methylpyridazin-3-one |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760 mmHg |
| Molecular Formula | C10H17N2O3PS2 |
| Molecular Weight | 308.35700 |
| Flash Point | 188.2ºC |
| Exact Mass | 308.04200 |
| PSA | 120.55000 |
| LogP | 3.19050 |
| Index of Refraction | 1.588 |
| InChIKey | BNMJWNASOCWVOX-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCn1nc(C)ccc1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |