1-Propanone,1-[4-(phenylmethoxy)phenyl]-3-(1-piperidinyl)-, hydrochloride (1:1)
Modify Date: 2025-09-24 15:16:49
![1-Propanone,1-[4-(phenylmethoxy)phenyl]-3-(1-piperidinyl)-, hydrochloride (1:1) Structure](https://image.chemsrc.com/caspic/123/51345-82-5.png)
1-Propanone,1-[4-(phenylmethoxy)phenyl]-3-(1-piperidinyl)-, hydrochloride (1:1) structure
|
Common Name | 1-Propanone,1-[4-(phenylmethoxy)phenyl]-3-(1-piperidinyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 51345-82-5 | Molecular Weight | 359.89000 | |
| Density | 1.093g/cm3 | Boiling Point | 484.3ºC at 760mmHg | |
| Molecular Formula | C21H26ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 1-(4-phenylmethoxyphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride |
|---|
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 484.3ºC at 760mmHg |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.89000 |
| Flash Point | 246.7ºC |
| Exact Mass | 359.16500 |
| PSA | 29.54000 |
| LogP | 5.06420 |
| Index of Refraction | 1.567 |
| InChIKey | JOARAHCRDCIAQS-UHFFFAOYSA-N |
| SMILES | Cl.O=C(CCN1CCCCC1)c1ccc(OCc2ccccc2)cc1 |
|
~%
1-Propanone,1-[... CAS#:51345-82-5 |
| Literature: Bockstahler; Wright Journal of the American Pharmaceutical Association (1912-1977), 1957 , vol. 46, p. 542,544 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |