4-chloro-N-(2-nitrophenyl)sulfanylaniline structure
|
Common Name | 4-chloro-N-(2-nitrophenyl)sulfanylaniline | ||
|---|---|---|---|---|
| CAS Number | 51343-01-2 | Molecular Weight | 280.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-(2-nitrophenyl)sulfanylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9ClN2O2S |
|---|---|
| Molecular Weight | 280.73000 |
| Exact Mass | 280.00700 |
| PSA | 83.15000 |
| LogP | 4.96360 |
| InChIKey | LZFQZBBYTVMCKC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1SNc1ccc(Cl)cc1 |
|
~%
4-chloro-N-(2-n... CAS#:51343-01-2 |
| Literature: Billman; O'Mahony Journal of the American Chemical Society, 1939 , vol. 61, p. 2340 |
| o-Nitrobenzolsulfen-p-chloranilid |
| 4'-chloro-2-nitrobenzenesulphenanilide |
| 4'-Chlor-2-nitrobenzolsulfenanilid |