Propanoic acid, 2-(4-phenoxyphenoxy)-
Modify Date: 2025-08-20 15:30:21
Propanoic acid, 2-(4-phenoxyphenoxy)- structure
|
Common Name | Propanoic acid, 2-(4-phenoxyphenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 51338-26-2 | Molecular Weight | 258.26900 | |
| Density | 1.218g/cm3 | Boiling Point | 405.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.2ºC | |
| Name | Propanoic acid, 2-(4-phenoxyphenoxy) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 405.9ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 151.2ºC |
| Exact Mass | 258.08900 |
| PSA | 55.76000 |
| LogP | 3.33080 |
| Index of Refraction | 1.575 |
| InChIKey | GQJSEWJUWSSORX-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2ccccc2)cc1)C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
Propanoic acid,... CAS#:51338-26-2 |
| Literature: Azzolina; Collina; Ghislandi Farmaco, 1993 , vol. 48, # 10 p. 1401 - 1416 |
|
~%
Propanoic acid,... CAS#:51338-26-2 |
| Literature: Hoffmann-La Roche Patent: DE613125 , 1923 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 22, p. 514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-(1-Propylpentyl)phenol |
| 2-(4-Octyl)phenol |
| o-(4-octyl)phenol |
| 4-(2-Hydroxyphenyl)octane |
| 2-(1-Propylpentyl)-phenol |
| 2-(4-Phenoxy-phenoxy)-propionsaeure |
| Phenol,2-(1-propylpentyl) |
| o-(1-Propylamyl)phenol |
| 2-(4-phenoxy-phenoxy)-propionic acid |
| O-(4-Phenoxy-phenyl)-DL-milchsaeure |