magnesium,methanidyl(trimethyl)silane
Modify Date: 2025-09-20 20:14:57
magnesium,methanidyl(trimethyl)silane structure
|
Common Name | magnesium,methanidyl(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 51329-17-0 | Molecular Weight | 198.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H22MgSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | magnesium,methanidyl(trimethyl)silane |
|---|
| Molecular Formula | C8H22MgSi2 |
|---|---|
| Molecular Weight | 198.73600 |
| Exact Mass | 198.11100 |
| LogP | 2.67660 |
| InChIKey | ZTWKHHFNBVGQTM-UHFFFAOYSA-N |
| SMILES | [CH2-][Si](C)(C)C.[CH2-][Si](C)(C)C.[Mg+2] |
|
~%
magnesium,metha... CAS#:51329-17-0 |
| Literature: Andersen,R.A.; Wilkinson,G. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1977 , p. 809 - 811 |
![[(Trimethylsilyl)Methyl]Magnesium Chloride structure](https://image.chemsrc.com/caspic/432/13170-43-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |