Butanamide,N-(3,4-dichlorophenyl)-3-oxo- structure
|
Common Name | Butanamide,N-(3,4-dichlorophenyl)-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 51309-24-1 | Molecular Weight | 246.090 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 423.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1±28.7 °C | |
| Name | N-(3,4-dichlorophenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.9±45.0 °C at 760 mmHg |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.090 |
| Flash Point | 210.1±28.7 °C |
| Exact Mass | 245.001038 |
| PSA | 49.66000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | BPAFBORSRKBCPI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3,4-Dichlorophenyl)-3-oxobutanamide |
| Butanamide, N-(3,4-dichlorophenyl)-3-oxo- |
| Butanamide,N-(3,4-dichlorophenyl)-3-oxo- |