Bis((4-(1-methylethyl)phenyl)methyl)-3-pyridinylcarbonimidodithioate structure
|
Common Name | Bis((4-(1-methylethyl)phenyl)methyl)-3-pyridinylcarbonimidodithioate | ||
|---|---|---|---|---|
| CAS Number | 51308-75-9 | Molecular Weight | 434.66000 | |
| Density | 1.08g/cm3 | Boiling Point | 573.2ºC at 760 mmHg | |
| Molecular Formula | C26H30N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.4ºC | |
| Name | 1,1-bis[(4-propan-2-ylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimine |
|---|
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 573.2ºC at 760 mmHg |
| Molecular Formula | C26H30N2S2 |
| Molecular Weight | 434.66000 |
| Flash Point | 300.4ºC |
| Exact Mass | 434.18500 |
| PSA | 75.85000 |
| LogP | 8.18270 |
| Index of Refraction | 1.593 |
| InChIKey | WKSPJMUKEYTLGZ-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(CSC(=Nc2cccnc2)SCc2ccc(C(C)C)cc2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |