(4-(1,1-Dimethylethyl)phenyl)methyl 1-ethyl-1-methylpropyl-3-pyridinylcarbonimidodithioate structure
|
Common Name | (4-(1,1-Dimethylethyl)phenyl)methyl 1-ethyl-1-methylpropyl-3-pyridinylcarbonimidodithioate | ||
|---|---|---|---|---|
| CAS Number | 51308-59-9 | Molecular Weight | 400.64400 | |
| Density | 1.02g/cm3 | Boiling Point | 516.4ºC at 760mmHg | |
| Molecular Formula | C23H32N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
| Name | 1-[(4-tert-butylphenyl)methylsulfanyl]-1-(3-methylpentan-3-ylsulfanyl)-N-pyridin-3-ylmethanimine |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 516.4ºC at 760mmHg |
| Molecular Formula | C23H32N2S2 |
| Molecular Weight | 400.64400 |
| Flash Point | 266.1ºC |
| Exact Mass | 400.20100 |
| PSA | 75.85000 |
| LogP | 7.61190 |
| Index of Refraction | 1.555 |
| InChIKey | IKQLWDOBBHJGCZ-UHFFFAOYSA-N |
| SMILES | CCC(C)(CC)SC(=Nc1cccnc1)SCc1ccc(C(C)(C)C)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |