MS438
Modify Date: 2025-08-27 21:22:22
MS438 structure
|
Common Name | MS438 | ||
|---|---|---|---|---|
| CAS Number | 512840-45-8 | Molecular Weight | 390.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MS438MS438 is a potent agonist of the TSH receptor (TSHR). |
| Name | MS438 |
|---|
| Description | MS438 is a potent agonist of the TSH receptor (TSHR). |
|---|
| Molecular Formula | C20H17F3N2O3 |
|---|---|
| Molecular Weight | 390.36 |
| InChIKey | CRJLZKUONIFOEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccc(C(F)(F)F)cc2)NC(=O)N1 |