butyl prop-2-enoate,ethyl prop-2-enoate,styrene structure
|
Common Name | butyl prop-2-enoate,ethyl prop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 51243-47-1 | Molecular Weight | 332.43400 | |
| Density | N/A | Boiling Point | 145.9ºC at 760mmHg | |
| Molecular Formula | C20H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.4ºC | |
| Name | butyl prop-2-enoate,ethyl prop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.43400 |
| Flash Point | 39.4ºC |
| Exact Mass | 332.19900 |
| PSA | 52.60000 |
| LogP | 4.58080 |
| InChIKey | CKDRPPBTNRFVHP-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| Styrene,ethyl acrylate,n-butyl acrylate polymer |
| 2-Propenoic acid,butyl ester,polymer with ethenylbenzene and ethyl 2-propenoate |