1,3,5-Triazine-2,4-diamine,6,6'-(1,2-phenylene) bis- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6,6'-(1,2-phenylene) bis- | ||
|---|---|---|---|---|
| CAS Number | 5118-79-6 | Molecular Weight | 296.29100 | |
| Density | 1.572g/cm3 | Boiling Point | 834.1ºC at 760 mmHg | |
| Molecular Formula | C12H12N10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 502.3ºC | |
| Name | 6-[2-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 834.1ºC at 760 mmHg |
| Molecular Formula | C12H12N10 |
| Molecular Weight | 296.29100 |
| Flash Point | 502.3ºC |
| Exact Mass | 296.12500 |
| PSA | 181.42000 |
| LogP | 2.04420 |
| Index of Refraction | 1.804 |
| InChIKey | FNNFAYGKUXMHSH-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccccc2-c2nc(N)nc(N)n2)n1 |
| HS Code | 2933699090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Phthaloguanamin |
| 6,6'-o-Phenylen-bis-[1,3,5]triazin-2,4-diyldiamin |
| s-Triazine,2,2'-O-phenylene-bis[4,6-diamino |
| 6,6'-o-phenylene-bis-[1,3,5]triazine-2,4-diyldiamine |
| o-Phtaloguanamin |
| 6,6'-o-phenylene-bis-[1,3,5]triazine-2,4-diamine |
| 6,6'-(1,2-phenylene)bis(1,3,5-triazine-2,4-diamine) |
| 1,2-bis(2,4-diamino-1,3,5-triazin-6-yl)benzene |