4-oxochromene-2-carbonyl chloride structure
|
Common Name | 4-oxochromene-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 5112-47-0 | Molecular Weight | 208.59800 | |
| Density | 1.477g/cm3 | Boiling Point | 305.6ºC at 760 mmHg | |
| Molecular Formula | C10H5ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | 4-oxochromene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 305.6ºC at 760 mmHg |
| Molecular Formula | C10H5ClO3 |
| Molecular Weight | 208.59800 |
| Flash Point | 135.7ºC |
| Exact Mass | 207.99300 |
| PSA | 47.28000 |
| LogP | 2.17200 |
| Index of Refraction | 1.613 |
| InChIKey | FAEHWELEABAGRQ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc(=O)c2ccccc2o1 |
| HS Code | 2918300090 |
|---|
|
~89%
4-oxochromene-2... CAS#:5112-47-0 |
| Literature: Peet, Norton P.; Sunder. Shyam Journal of Organic Chemistry, 1980 , vol. 45, # 3 p. 536 - 538 |
|
~%
4-oxochromene-2... CAS#:5112-47-0 |
| Literature: Josey, Benjamin J.; Inks, Elizabeth S.; Wen, Xuejun; Chou, C. James Journal of Medicinal Chemistry, 2013 , vol. 56, # 3 p. 1007 - 1022 |
|
~%
4-oxochromene-2... CAS#:5112-47-0 |
| Literature: Sagorewskii et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 1026,1029; engl. Ausg. S. 1004, 1006 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-oxo-4H-1-benzopyrane-2-carboxylic acid chloride |
| 4-Oxo-4H-chromen-2-carbonylchlorid |
| 4-Oxo-4H-1-benzopyran-2-carbonyl chloride |
| 4-Oxo-4H-chromene-2-carbonyl chloride |
| chromone-2-carboxylic acid chloride |
| F2190-0140 |