2-[1-(carboxymethyl)-4,4-dimethyl-cyclohexyl]acetic acid structure
|
Common Name | 2-[1-(carboxymethyl)-4,4-dimethyl-cyclohexyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 51111-28-5 | Molecular Weight | 228.28500 | |
| Density | 1.099g/cm3 | Boiling Point | 399.6ºC at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-(carboxymethyl)-4,4-dimethylcyclohexyl]acetic acid |
|---|
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 399.6ºC at 760 mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Exact Mass | 228.13600 |
| PSA | 74.60000 |
| LogP | 2.52240 |
| Index of Refraction | 1.476 |
| InChIKey | AYBICQCXGRPBLK-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(CC(=O)O)(CC(=O)O)CC1 |
|
~%
2-[1-(carboxyme... CAS#:51111-28-5 |
| Literature: Rice; Sheth; Wheeler Journal of Heterocyclic Chemistry, 1973 , vol. 10, # 5 p. 731 - 735 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |