2-Chloro-N,2-diphenylacetamide structure
|
Common Name | 2-Chloro-N,2-diphenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 5110-77-0 | Molecular Weight | 245.70400 | |
| Density | 1.257g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 2-Chloro-N,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 216.7ºC |
| Exact Mass | 245.06100 |
| PSA | 29.10000 |
| LogP | 3.67820 |
| Index of Refraction | 1.634 |
| InChIKey | FMADJSSGSBCKGZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)C(Cl)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N,2-diphenyl-acetamide |
| Chlor-phenyl-essigsaeure-anilid |
| 1-phenyl-1-chloroacetanilide |
| chloro-phenyl-acetic acid anilide |
| 2-chloro-2-phenyl-N-phenylacetamide |