lysine, N6-benzoyl- structure
|
Common Name | lysine, N6-benzoyl- | ||
|---|---|---|---|---|
| CAS Number | 5107-18-6 | Molecular Weight | 250.29400 | |
| Density | 1.186 g/cm3 | Boiling Point | 521ºC at 760mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | 268ºC | |
| MSDS | N/A | Flash Point | 268.9ºC | |
| Name | 2-amino-6-benzamidohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186 g/cm3 |
|---|---|
| Boiling Point | 521ºC at 760mmHg |
| Melting Point | 268ºC |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29400 |
| Flash Point | 268.9ºC |
| Exact Mass | 250.13200 |
| PSA | 92.42000 |
| LogP | 2.08980 |
| Index of Refraction | 1.558 |
| InChIKey | KODLJWKGAKBGOB-UHFFFAOYSA-N |
| SMILES | NC(CCCCNC(=O)c1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: v. Braun Chemische Berichte, 1909 , vol. 42, p. 839 |
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: Kurtz Journal of Biological Chemistry, 1949 , vol. 180, p. 1253,1258 |
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: v. Braun Chemische Berichte, 1909 , vol. 42, p. 839 |
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: v. Braun Chemische Berichte, 1909 , vol. 42, p. 839 |
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: Enger; Halle Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1930 , vol. 191, p. 103,109 |
|
~%
lysine, N6-benzoyl- CAS#:5107-18-6 |
| Literature: Goldschmidt; Fuener Justus Liebigs Annalen der Chemie, 1930 , vol. 483, p. 190,195, 201, 207, 211, 213 |
| Precursor 6 | |
|---|---|
| DownStream 7 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| F0266-0844 |
| N6-benzoyl-lysine |
| N-l-benzoyl lysine |
| N6-Benzoyl-lysin |
| 2-amino-6-(benzoylamino)hexanoic acid |
| N6-benzoyl-DL-lysine |
| 2-amino-6-(phenylcarbonylamino)hexanoic acid |
| Nepsilon-Benzoyllysine |
| N~6~-(phenylcarbonyl)lysine |
| N6-benzoyl-D-lysine |