(4S)-4-bromo-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione
Modify Date: 2025-09-05 12:18:17
![(4S)-4-bromo-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione Structure](https://image.chemsrc.com/caspic/247/51057-37-5.png)
(4S)-4-bromo-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione structure
|
Common Name | (4S)-4-bromo-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 51057-37-5 | Molecular Weight | 231.08600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4S)-4-bromo-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|
| Molecular Formula | C9H11BrO2 |
|---|---|
| Molecular Weight | 231.08600 |
| Exact Mass | 229.99400 |
| PSA | 34.14000 |
| LogP | 1.70810 |
| InChIKey | GMKNYAFHSAMAFC-OLAZFDQMSA-N |
| SMILES | CC1(C)C2CCC1(Br)C(=O)C2=O |
|
~%
(4S)-4-bromo-7,... CAS#:51057-37-5 |
| Literature: Kokke,W.C.M.C.; Varkevisser,F.A. Journal of Organic Chemistry, 1974 , vol. 39, # 12 p. 1653 - 1656 |
|
~%
(4S)-4-bromo-7,... CAS#:51057-37-5 |
| Literature: Kokke,W.C.M.C.; Varkevisser,F.A. Journal of Organic Chemistry, 1974 , vol. 39, # 12 p. 1653 - 1656 |
![(1S,4R)-1-bromo-7,7-dimethylbicyclo[2.2.1]heptan-2-one structure](https://image.chemsrc.com/caspic/361/51057-34-2.png)
![7,7-DIMETHYL-2-OXOBICYCLO[2.2.1]HEPTANE-1-CARBOXYLIC ACID structure](https://image.chemsrc.com/caspic/495/464-78-8.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |